C23H35NO6S4 — CID 159018116
2-[2-(2-methylprop-2-enoyloxy)ethyldisulfanyl]ethyl 2-methylprop-2-enoate;N-[2-(4-oxohex-5-enyldisulfanyl)ethyl]prop-2-enamide (PubChem CID 159018116) has the molecular formula C23H35NO6S4 and a molecular weight of 549.80 g/mol. Its IUPAC name is 2-[2-(2-methylprop-2-enoyloxy)ethyldisulfanyl]ethyl 2-methylprop-2-enoate;N-[2-(4-oxohex-5-enyldisulfanyl)ethyl]prop-2-enamide.
| Compound Name | 2-[2-(2-methylprop-2-enoyloxy)ethyldisulfanyl]ethyl 2-methylprop-2-enoate;N-[2-(4-oxohex-5-enyldisulfanyl)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 159018116 |
| Molecular Formula | C23H35NO6S4 |
| Molecular Weight | 549.80 g/mol |
| Exact Mass | 549.13 |
| IUPAC Name | 2-[2-(2-methylprop-2-enoyloxy)ethyldisulfanyl]ethyl 2-methylprop-2-enoate;N-[2-(4-oxohex-5-enyldisulfanyl)ethyl]prop-2-enamide |
| SMILES | C=C(C)C(=O)OCCSSCCOC(=O)C(=C)C.C=CC(=O)CCCSSCCNC(=O)C=C |
| InChI | InChI=1S/C12H18O4S2.C11H17NO2S2/c1-9(2)11(13)15-5-7-17-18-8-6-16-12(14)10(3)4;1-3-10(13)6-5-8-15-16-9-7-12-11(14)4-2/h1,3,5-8H2,2,4H3;3-4H,1-2,5-9H2,(H,12,14) |
| InChIKey | JTIOHXLKZJAHPW-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.80 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|