C21H27Cl2NO10 — CID 161195004
6-hydroxyhex-1-en-3-one;oxalyl dichloride;1-O-(4-oxohex-5-enyl) 2-O-[2-(prop-2-enoylamino)ethyl] oxalate (PubChem CID 161195004) has the molecular formula C21H27Cl2NO10 and a molecular weight of 524.35 g/mol. Its IUPAC name is 6-hydroxyhex-1-en-3-one;oxalyl dichloride;1-O-(4-oxohex-5-enyl) 2-O-[2-(prop-2-enoylamino)ethyl] oxalate.
| Compound Name | 6-hydroxyhex-1-en-3-one;oxalyl dichloride;1-O-(4-oxohex-5-enyl) 2-O-[2-(prop-2-enoylamino)ethyl] oxalate |
|---|---|
| PubChem CID | 161195004 |
| Molecular Formula | C21H27Cl2NO10 |
| Molecular Weight | 524.35 g/mol |
| Exact Mass | 523.10 |
| IUPAC Name | 6-hydroxyhex-1-en-3-one;oxalyl dichloride;1-O-(4-oxohex-5-enyl) 2-O-[2-(prop-2-enoylamino)ethyl] oxalate |
| SMILES | C=CC(=O)CCCO.C=CC(=O)CCCOC(=O)C(=O)OCCNC(=O)C=C.O=C(Cl)C(=O)Cl |
| InChI | InChI=1S/C13H17NO6.C6H10O2.C2Cl2O2/c1-3-10(15)6-5-8-19-12(17)13(18)20-9-7-14-11(16)4-2;1-2-6(8)4-3-5-7;3-1(5)2(4)6/h3-4H,1-2,5-9H2,(H,14,16);2,7H,1,3-5H2; |
| InChIKey | UUFMAEVIGPCKCJ-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 170.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.35 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|