C11H17NO5S2 — CID 143799212
2-[3-[2-(2-methylprop-2-enoyloxy)ethyldisulfanyl]propanoylamino]acetic acid (PubChem CID 143799212) has the molecular formula C11H17NO5S2 and a molecular weight of 307.39 g/mol. Its IUPAC name is 2-[3-[2-(2-methylprop-2-enoyloxy)ethyldisulfanyl]propanoylamino]acetic acid.
| Compound Name | 2-[3-[2-(2-methylprop-2-enoyloxy)ethyldisulfanyl]propanoylamino]acetic acid |
|---|---|
| PubChem CID | 143799212 |
| Molecular Formula | C11H17NO5S2 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.05 |
| IUPAC Name | 2-[3-[2-(2-methylprop-2-enoyloxy)ethyldisulfanyl]propanoylamino]acetic acid |
| SMILES | C=C(C)C(=O)OCCSSCCC(=O)NCC(=O)O |
| InChI | InChI=1S/C11H17NO5S2/c1-8(2)11(16)17-4-6-19-18-5-3-9(13)12-7-10(14)15/h1,3-7H2,2H3,(H,12,13)(H,14,15) |
| InChIKey | SNDKUBCWFXBLMT-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|