C17H26N2O5S2 — CID 123561638
2-[2-(2-methylprop-2-enoyloxy)ethyldisulfanyl]ethyl 2-methylidene-4-[(prop-2-enoylamino)methylamino]butanoate (PubChem CID 123561638) has the molecular formula C17H26N2O5S2 and a molecular weight of 402.54 g/mol. Its IUPAC name is 2-[2-(2-methylprop-2-enoyloxy)ethyldisulfanyl]ethyl 2-methylidene-4-[(prop-2-enoylamino)methylamino]butanoate.
| Compound Name | 2-[2-(2-methylprop-2-enoyloxy)ethyldisulfanyl]ethyl 2-methylidene-4-[(prop-2-enoylamino)methylamino]butanoate |
|---|---|
| PubChem CID | 123561638 |
| Molecular Formula | C17H26N2O5S2 |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | 2-[2-(2-methylprop-2-enoyloxy)ethyldisulfanyl]ethyl 2-methylidene-4-[(prop-2-enoylamino)methylamino]butanoate |
| SMILES | C=CC(=O)NCNCCC(=C)C(=O)OCCSSCCOC(=O)C(=C)C |
| InChI | InChI=1S/C17H26N2O5S2/c1-5-15(20)19-12-18-7-6-14(4)17(22)24-9-11-26-25-10-8-23-16(21)13(2)3/h5,18H,1-2,4,6-12H2,3H3,(H,19,20) |
| InChIKey | MSBZSNVHNQAGMS-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|