C11H15NO2S2 — CID 144786341
2-[[(1E)-1-(methylideneamino)buta-1,3-dienyl]disulfanyl]ethyl 2-methylprop-2-enoate (PubChem CID 144786341) has the molecular formula C11H15NO2S2 and a molecular weight of 257.38 g/mol. Its IUPAC name is 2-[[(1E)-1-(methylideneamino)buta-1,3-dienyl]disulfanyl]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[[(1E)-1-(methylideneamino)buta-1,3-dienyl]disulfanyl]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 144786341 |
| Molecular Formula | C11H15NO2S2 |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.05 |
| IUPAC Name | 2-[[(1E)-1-(methylideneamino)buta-1,3-dienyl]disulfanyl]ethyl 2-methylprop-2-enoate |
| SMILES | C=C/C=C(\N=C)SSCCOC(=O)C(=C)C |
| InChI | InChI=1S/C11H15NO2S2/c1-5-6-10(12-4)16-15-8-7-14-11(13)9(2)3/h5-6H,1-2,4,7-8H2,3H3/b10-6+ |
| InChIKey | PWJNMMJUBJIRKD-UXBLZVDNSA-N |
| XLogP | 3.22 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|