C12H19NO2S2 — CID 143799210
2-[[C-[(Z)-but-1-enyl]-N-methylcarbonimidoyl]disulfanyl]ethyl 2-methylprop-2-enoate (PubChem CID 143799210) has the molecular formula C12H19NO2S2 and a molecular weight of 273.42 g/mol. Its IUPAC name is 2-[[C-[(Z)-but-1-enyl]-N-methylcarbonimidoyl]disulfanyl]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[[C-[(Z)-but-1-enyl]-N-methylcarbonimidoyl]disulfanyl]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 143799210 |
| Molecular Formula | C12H19NO2S2 |
| Molecular Weight | 273.42 g/mol |
| Exact Mass | 273.09 |
| IUPAC Name | 2-[[C-[(Z)-but-1-enyl]-N-methylcarbonimidoyl]disulfanyl]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCSSC(/C=C\CC)=N\C |
| InChI | InChI=1S/C12H19NO2S2/c1-5-6-7-11(13-4)17-16-9-8-15-12(14)10(2)3/h6-7H,2,5,8-9H2,1,3-4H3/b7-6-,13-11- |
| InChIKey | QSBYUSMKDBGYTE-FICPNTFISA-N |
| XLogP | 3.48 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.42 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|