C7H15N3O — CID 138461440
N-[2-amino-2-(ethylamino)ethyl]prop-2-enamide (PubChem CID 138461440) has the molecular formula C7H15N3O and a molecular weight of 157.22 g/mol. Its IUPAC name is N-[2-amino-2-(ethylamino)ethyl]prop-2-enamide.
| Compound Name | N-[2-amino-2-(ethylamino)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 138461440 |
| Molecular Formula | C7H15N3O |
| Molecular Weight | 157.22 g/mol |
| Exact Mass | 157.12 |
| IUPAC Name | N-[2-amino-2-(ethylamino)ethyl]prop-2-enamide |
| SMILES | C=CC(=O)NCC(N)NCC |
| InChI | InChI=1S/C7H15N3O/c1-3-7(11)10-5-6(8)9-4-2/h3,6,9H,1,4-5,8H2,2H3,(H,10,11) |
| InChIKey | RKHKWAWNWOWTRQ-UHFFFAOYSA-N |
| XLogP | -0.82 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.22 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|