C8H12NNaO3 — CID 175047548
sodium 3-methyl-4-(prop-2-enoylamino)butanoate (PubChem CID 175047548) has the molecular formula C8H12NNaO3 and a molecular weight of 193.18 g/mol. Its IUPAC name is sodium 3-methyl-4-(prop-2-enoylamino)butanoate.
| Compound Name | sodium 3-methyl-4-(prop-2-enoylamino)butanoate |
|---|---|
| PubChem CID | 175047548 |
| Molecular Formula | C8H12NNaO3 |
| Molecular Weight | 193.18 g/mol |
| Exact Mass | 193.07 |
| IUPAC Name | sodium 3-methyl-4-(prop-2-enoylamino)butanoate |
| SMILES | C=CC(=O)NCC(C)CC(=O)[O-].[Na+] |
| InChI | InChI=1S/C8H13NO3.Na/c1-3-7(10)9-5-6(2)4-8(11)12;/h3,6H,1,4-5H2,2H3,(H,9,10)(H,11,12);/q;+1/p-1 |
| InChIKey | WBKIWLQIRRCCML-UHFFFAOYSA-M |
| XLogP | -3.93 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.18 |
| LogP ≤ 5 | -3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|