C10H17NO — CID 57407652
N-(4-methyl-2-methylidenepentyl)prop-2-enamide (PubChem CID 57407652) has the molecular formula C10H17NO and a molecular weight of 167.25 g/mol. Its IUPAC name is N-(4-methyl-2-methylidenepentyl)prop-2-enamide.
| Compound Name | N-(4-methyl-2-methylidenepentyl)prop-2-enamide |
|---|---|
| PubChem CID | 57407652 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | N-(4-methyl-2-methylidenepentyl)prop-2-enamide |
| SMILES | C=CC(=O)NCC(=C)CC(C)C |
| InChI | InChI=1S/C10H17NO/c1-5-10(12)11-7-9(4)6-8(2)3/h5,8H,1,4,6-7H2,2-3H3,(H,11,12) |
| InChIKey | LMMLGSZPVQHEEQ-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|