C18H28N4O3 — CID 155201474
N-[2-[(but-3-en-2-ylamino)methyl]-3-(prop-2-enoylamino)-2-[(prop-2-enoylamino)methyl]propyl]prop-2-enamide (PubChem CID 155201474) has the molecular formula C18H28N4O3 and a molecular weight of 348.45 g/mol. Its IUPAC name is N-[2-[(but-3-en-2-ylamino)methyl]-3-(prop-2-enoylamino)-2-[(prop-2-enoylamino)methyl]propyl]prop-2-enamide.
| Compound Name | N-[2-[(but-3-en-2-ylamino)methyl]-3-(prop-2-enoylamino)-2-[(prop-2-enoylamino)methyl]propyl]prop-2-enamide |
|---|---|
| PubChem CID | 155201474 |
| Molecular Formula | C18H28N4O3 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.22 |
| IUPAC Name | N-[2-[(but-3-en-2-ylamino)methyl]-3-(prop-2-enoylamino)-2-[(prop-2-enoylamino)methyl]propyl]prop-2-enamide |
| SMILES | C=CC(=O)NCC(CNC(=O)C=C)(CNC(=O)C=C)CNC(C)C=C |
| InChI | InChI=1S/C18H28N4O3/c1-6-14(5)19-10-18(11-20-15(23)7-2,12-21-16(24)8-3)13-22-17(25)9-4/h6-9,14,19H,1-4,10-13H2,5H3,(H,20,23)(H,21,24)(H,22,25) |
| InChIKey | DLTOWDHCHXCYBU-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 99.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|