C14H24FeN2O8 — CID 174859662
2-hydroxy-2-[2-oxo-2-[2-(trimethylazaniumyl)ethoxy]ethyl]butanedioate;iron(2+);2-(methylamino)ethanone (PubChem CID 174859662) has the molecular formula C14H24FeN2O8 and a molecular weight of 404.20 g/mol. Its IUPAC name is 2-hydroxy-2-[2-oxo-2-[2-(trimethylazaniumyl)ethoxy]ethyl]butanedioate;iron(2+);2-(methylamino)ethanone.
| Compound Name | 2-hydroxy-2-[2-oxo-2-[2-(trimethylazaniumyl)ethoxy]ethyl]butanedioate;iron(2+);2-(methylamino)ethanone |
|---|---|
| PubChem CID | 174859662 |
| Molecular Formula | C14H24FeN2O8 |
| Molecular Weight | 404.20 g/mol |
| Exact Mass | 404.09 |
| IUPAC Name | 2-hydroxy-2-[2-oxo-2-[2-(trimethylazaniumyl)ethoxy]ethyl]butanedioate;iron(2+);2-(methylamino)ethanone |
| SMILES | CNC[C-]=O.C[N+](C)(C)CCOC(=O)CC(O)(CC(=O)[O-])C(=O)[O-].[Fe+2] |
| InChI | InChI=1S/C11H19NO7.C3H6NO.Fe/c1-12(2,3)4-5-19-9(15)7-11(18,10(16)17)6-8(13)14;1-4-2-3-5;/h18H,4-7H2,1-3H3,(H-,13,14,16,17);4H,2H2,1H3;/q;-1;+2/p-1 |
| InChIKey | IZVHHKBAPDCNIP-UHFFFAOYSA-M |
| XLogP | -4.44 |
| TPSA | 155.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.20 |
| LogP ≤ 5 | -4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|