C32H56O14 — CID 175821252
2-hydroxy-5,9-dimethylundecane-1,2,3-tricarboxylic acid;2-hydroxy-2-[2-(8-methylnonoxy)-2-oxoethyl]butanedioic acid (PubChem CID 175821252) has the molecular formula C32H56O14 and a molecular weight of 664.79 g/mol. Its IUPAC name is 2-hydroxy-5,9-dimethylundecane-1,2,3-tricarboxylic acid;2-hydroxy-2-[2-(8-methylnonoxy)-2-oxoethyl]butanedioic acid.
| Compound Name | 2-hydroxy-5,9-dimethylundecane-1,2,3-tricarboxylic acid;2-hydroxy-2-[2-(8-methylnonoxy)-2-oxoethyl]butanedioic acid |
|---|---|
| PubChem CID | 175821252 |
| Molecular Formula | C32H56O14 |
| Molecular Weight | 664.79 g/mol |
| Exact Mass | 664.37 |
| IUPAC Name | 2-hydroxy-5,9-dimethylundecane-1,2,3-tricarboxylic acid;2-hydroxy-2-[2-(8-methylnonoxy)-2-oxoethyl]butanedioic acid |
| SMILES | CC(C)CCCCCCCOC(=O)CC(O)(CC(=O)O)C(=O)O.CCC(C)CCCC(C)CC(C(=O)O)C(O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/2C16H28O7/c1-12(2)8-6-4-3-5-7-9-23-14(19)11-16(22,15(20)21)10-13(17)18;1-4-10(2)6-5-7-11(3)8-12(14(19)20)16(23,15(21)22)9-13(17)18/h12,22H,3-11H2,1-2H3,(H,17,18)(H,20,21);10-12,23H,4-9H2,1-3H3,(H,17,18)(H,19,20)(H,21,22) |
| InChIKey | BVSOLIYRTOXNIB-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 253.26 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.79 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|