C8H12O7 — CID 88508784
2-acetyloxy-4-ethoxy-2-hydroxy-4-oxobutanoic acid (PubChem CID 88508784) has the molecular formula C8H12O7 and a molecular weight of 220.18 g/mol. Its IUPAC name is 2-acetyloxy-4-ethoxy-2-hydroxy-4-oxobutanoic acid.
| Compound Name | 2-acetyloxy-4-ethoxy-2-hydroxy-4-oxobutanoic acid |
|---|---|
| PubChem CID | 88508784 |
| Molecular Formula | C8H12O7 |
| Molecular Weight | 220.18 g/mol |
| Exact Mass | 220.06 |
| IUPAC Name | 2-acetyloxy-4-ethoxy-2-hydroxy-4-oxobutanoic acid |
| SMILES | CCOC(=O)CC(O)(OC(C)=O)C(=O)O |
| InChI | InChI=1S/C8H12O7/c1-3-14-6(10)4-8(13,7(11)12)15-5(2)9/h13H,3-4H2,1-2H3,(H,11,12) |
| InChIKey | HZCRTSAFZMCXEX-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.18 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|