C22H36O14 — CID 87972924
3-ethyl-4-hydroxyheptane-2,3,4-tricarboxylic acid;3-ethyl-2-hydroxypentane-1,2,3-tricarboxylic acid (PubChem CID 87972924) has the molecular formula C22H36O14 and a molecular weight of 524.52 g/mol. Its IUPAC name is 3-ethyl-4-hydroxyheptane-2,3,4-tricarboxylic acid;3-ethyl-2-hydroxypentane-1,2,3-tricarboxylic acid.
| Compound Name | 3-ethyl-4-hydroxyheptane-2,3,4-tricarboxylic acid;3-ethyl-2-hydroxypentane-1,2,3-tricarboxylic acid |
|---|---|
| PubChem CID | 87972924 |
| Molecular Formula | C22H36O14 |
| Molecular Weight | 524.52 g/mol |
| Exact Mass | 524.21 |
| IUPAC Name | 3-ethyl-4-hydroxyheptane-2,3,4-tricarboxylic acid;3-ethyl-2-hydroxypentane-1,2,3-tricarboxylic acid |
| SMILES | CCC(C(=O)O)C(O)(C(=O)O)C(CC)(CC)C(=O)O.CCC(CC)(C(=O)O)C(O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C12H20O7.C10H16O7/c1-4-7(8(13)14)12(19,10(17)18)11(5-2,6-3)9(15)16;1-3-9(4-2,7(13)14)10(17,8(15)16)5-6(11)12/h7,19H,4-6H2,1-3H3,(H,13,14)(H,15,16)(H,17,18);17H,3-5H2,1-2H3,(H,11,12)(H,13,14)(H,15,16) |
| InChIKey | QUQXHYIKTICVCA-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 264.26 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.52 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |