C11H12O10 — CID 88838111
2-[2-(3-carboxybut-3-enoyloxy)-2-oxoethyl]-2-hydroxybutanedioic acid (PubChem CID 88838111) has the molecular formula C11H12O10 and a molecular weight of 304.21 g/mol. Its IUPAC name is 2-[2-(3-carboxybut-3-enoyloxy)-2-oxoethyl]-2-hydroxybutanedioic acid.
| Compound Name | 2-[2-(3-carboxybut-3-enoyloxy)-2-oxoethyl]-2-hydroxybutanedioic acid |
|---|---|
| PubChem CID | 88838111 |
| Molecular Formula | C11H12O10 |
| Molecular Weight | 304.21 g/mol |
| Exact Mass | 304.04 |
| IUPAC Name | 2-[2-(3-carboxybut-3-enoyloxy)-2-oxoethyl]-2-hydroxybutanedioic acid |
| SMILES | C=C(CC(=O)OC(=O)CC(O)(CC(=O)O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C11H12O10/c1-5(9(16)17)2-7(14)21-8(15)4-11(20,10(18)19)3-6(12)13/h20H,1-4H2,(H,12,13)(H,16,17)(H,18,19) |
| InChIKey | MJJXAKDHBRRFBQ-UHFFFAOYSA-N |
| XLogP | -1.23 |
| TPSA | 175.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.21 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|