C6H9BO9 — CID 87318020
2-(2-boronooxy-2-oxoethyl)-2-hydroxybutanedioic acid (PubChem CID 87318020) has the molecular formula C6H9BO9 and a molecular weight of 235.94 g/mol. Its IUPAC name is 2-(2-boronooxy-2-oxoethyl)-2-hydroxybutanedioic acid.
| Compound Name | 2-(2-boronooxy-2-oxoethyl)-2-hydroxybutanedioic acid |
|---|---|
| PubChem CID | 87318020 |
| Molecular Formula | C6H9BO9 |
| Molecular Weight | 235.94 g/mol |
| Exact Mass | 236.03 |
| IUPAC Name | 2-(2-boronooxy-2-oxoethyl)-2-hydroxybutanedioic acid |
| SMILES | O=C(O)CC(O)(CC(=O)OB(O)O)C(=O)O |
| InChI | InChI=1S/C6H9BO9/c8-3(9)1-6(13,5(11)12)2-4(10)16-7(14)15/h13-15H,1-2H2,(H,8,9)(H,11,12) |
| InChIKey | YFDNBCSATKVKLT-UHFFFAOYSA-N |
| XLogP | -2.82 |
| TPSA | 161.59 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.94 |
| LogP ≤ 5 | -2.82 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|