C16H19NO24S3 — CID 89258382
2-[2-[4-(3,4-dicarboxy-3-hydroxybutanoyl)oxy-4-oxo-2,3,3-trisulfobutanimidoyl]oxy-2-oxoethyl]-2-hydroxybutanedioic acid (PubChem CID 89258382) has the molecular formula C16H19NO24S3 and a molecular weight of 705.51 g/mol. Its IUPAC name is 2-[2-[4-(3,4-dicarboxy-3-hydroxybutanoyl)oxy-4-oxo-2,3,3-trisulfobutanimidoyl]oxy-2-oxoethyl]-2-hydroxybutanedioic acid.
| Compound Name | 2-[2-[4-(3,4-dicarboxy-3-hydroxybutanoyl)oxy-4-oxo-2,3,3-trisulfobutanimidoyl]oxy-2-oxoethyl]-2-hydroxybutanedioic acid |
|---|---|
| PubChem CID | 89258382 |
| Molecular Formula | C16H19NO24S3 |
| Molecular Weight | 705.51 g/mol |
| Exact Mass | 704.95 |
| IUPAC Name | 2-[2-[4-(3,4-dicarboxy-3-hydroxybutanoyl)oxy-4-oxo-2,3,3-trisulfobutanimidoyl]oxy-2-oxoethyl]-2-hydroxybutanedioic acid |
| SMILES | [H]/N=C(\OC(=O)CC(O)(CC(=O)O)C(=O)O)C(C(C(=O)OC(=O)CC(O)(CC(=O)O)C(=O)O)(S(=O)(=O)O)S(=O)(=O)O)S(=O)(=O)O |
| InChI | InChI=1S/C16H19NO24S3/c17-10(40-7(22)3-14(29,11(24)25)1-5(18)19)9(42(31,32)33)16(43(34,35)36,44(37,38)39)13(28)41-8(23)4-15(30,12(26)27)2-6(20)21/h9,17,29-30H,1-4H2,(H,18,19)(H,20,21)(H,24,25)(H,26,27)(H,31,32,33)(H,34,35,36)(H,37,38,39)/b17-10- |
| InChIKey | QXPRNRZVJRWTAI-YVLHZVERSA-N |
| XLogP | -5.33 |
| TPSA | 446.29 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.51 |
| LogP ≤ 5 | -5.33 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|