C10H18O5 — CID 142318646
[(Z)-3-hydroperoxy-2-hydroxybut-2-enyl] 3,3-dimethylbutanoate (PubChem CID 142318646) has the molecular formula C10H18O5 and a molecular weight of 218.25 g/mol. Its IUPAC name is [(Z)-3-hydroperoxy-2-hydroxybut-2-enyl] 3,3-dimethylbutanoate.
| Compound Name | [(Z)-3-hydroperoxy-2-hydroxybut-2-enyl] 3,3-dimethylbutanoate |
|---|---|
| PubChem CID | 142318646 |
| Molecular Formula | C10H18O5 |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | [(Z)-3-hydroperoxy-2-hydroxybut-2-enyl] 3,3-dimethylbutanoate |
| SMILES | C/C(OO)=C(/O)COC(=O)CC(C)(C)C |
| InChI | InChI=1S/C10H18O5/c1-7(15-13)8(11)6-14-9(12)5-10(2,3)4/h11,13H,5-6H2,1-4H3/b8-7- |
| InChIKey | YRMYTQUISDWDNS-FPLPWBNLSA-N |
| XLogP | 2.24 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|