C15H23ClO8 — CID 163924122
1-O-(1-chloroethyl) 5-O-(1,3-diacetyloxypropan-2-yl) 3-methylpentanedioate (PubChem CID 163924122) has the molecular formula C15H23ClO8 and a molecular weight of 366.79 g/mol. Its IUPAC name is 1-O-(1-chloroethyl) 5-O-(1,3-diacetyloxypropan-2-yl) 3-methylpentanedioate.
| Compound Name | 1-O-(1-chloroethyl) 5-O-(1,3-diacetyloxypropan-2-yl) 3-methylpentanedioate |
|---|---|
| PubChem CID | 163924122 |
| Molecular Formula | C15H23ClO8 |
| Molecular Weight | 366.79 g/mol |
| Exact Mass | 366.11 |
| IUPAC Name | 1-O-(1-chloroethyl) 5-O-(1,3-diacetyloxypropan-2-yl) 3-methylpentanedioate |
| SMILES | CC(=O)OCC(COC(C)=O)OC(=O)CC(C)CC(=O)OC(C)Cl |
| InChI | InChI=1S/C15H23ClO8/c1-9(5-14(19)23-10(2)16)6-15(20)24-13(7-21-11(3)17)8-22-12(4)18/h9-10,13H,5-8H2,1-4H3 |
| InChIKey | RCYZNEGMTWPJGU-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.79 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|