About 3-methylbutyl propanoate;(4-methyl-2-propanoyloxypentyl) propanoate
3-methylbutyl propanoate;(4-methyl-2-propanoyloxypentyl) propanoate (PubChem CID 162076358) has the molecular formula C20H38O6
and a molecular weight of 374.52 g/mol. Its IUPAC name is 3-methylbutyl propanoate;(4-methyl-2-propanoyloxypentyl) propanoate.
Molecular Properties
| Compound Name | 3-methylbutyl propanoate;(4-methyl-2-propanoyloxypentyl) propanoate |
| PubChem CID | 162076358 |
| Molecular Formula | C20H38O6 |
| Molecular Weight | 374.52 g/mol |
| Exact Mass | 374.27 |
| IUPAC Name | 3-methylbutyl propanoate;(4-methyl-2-propanoyloxypentyl) propanoate |
| SMILES | CCC(=O)OCC(CC(C)C)OC(=O)CC.CCC(=O)OCCC(C)C |
| InChI | InChI=1S/C12H22O4.C8H16O2/c1-5-11(13)15-8-10(7-9(3)4)16-12(14)6-2;1-4-8(9)10-6-5-7(2)3/h9-10H,5-8H2,1-4H3;7H,4-6H2,1-3H3 |
| InChIKey | ZBTHKTUFMOJGMN-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.52 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|
Analyze 3-methylbutyl propanoate;(4-methyl-2-propanoyloxypentyl) propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylbutyl propanoate;(4-methyl-2-propanoyloxypentyl) propanoate?
The IUPAC name of 3-methylbutyl propanoate;(4-methyl-2-propanoyloxypentyl) propanoate (CID 162076358) is 3-methylbutyl propanoate;(4-methyl-2-propanoyloxypentyl) propanoate.
What is the SMILES notation for 3-methylbutyl propanoate;(4-methyl-2-propanoyloxypentyl) propanoate?
The canonical SMILES for 3-methylbutyl propanoate;(4-methyl-2-propanoyloxypentyl) propanoate is CCC(=O)OCC(CC(C)C)OC(=O)CC.CCC(=O)OCCC(C)C.
What is the InChIKey of 3-methylbutyl propanoate;(4-methyl-2-propanoyloxypentyl) propanoate?
The InChIKey is ZBTHKTUFMOJGMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22O4.C8H16O2/c1-5-11(13)15-8-10(7-9(3)4)16-12(14)6-2;1-4-8(9)10-6-5-7(2)3/h9-10H,5-8H2,1-4H3;7H,4-6H2,1-3H3.
What are the key properties of 3-methylbutyl propanoate;(4-methyl-2-propanoyloxypentyl) propanoate?
3-methylbutyl propanoate;(4-methyl-2-propanoyloxypentyl) propanoate has a molecular weight of 374.52 g/mol, XLogP of 4.29, 11 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylbutyl propanoate;(4-methyl-2-propanoyloxypentyl) propanoate is sourced from PubChem (CID 162076358), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).