C14H20O8 — CID 162351983
(E)-4-[(3R)-3,4-di(propanoyloxy)butoxy]-4-oxobut-2-enoic acid (PubChem CID 162351983) has the molecular formula C14H20O8 and a molecular weight of 316.31 g/mol. Its IUPAC name is (E)-4-[(3R)-3,4-di(propanoyloxy)butoxy]-4-oxobut-2-enoic acid.
| Compound Name | (E)-4-[(3R)-3,4-di(propanoyloxy)butoxy]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 162351983 |
| Molecular Formula | C14H20O8 |
| Molecular Weight | 316.31 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | (E)-4-[(3R)-3,4-di(propanoyloxy)butoxy]-4-oxobut-2-enoic acid |
| SMILES | CCC(=O)OC[C@@H](CCOC(=O)/C=C/C(=O)O)OC(=O)CC |
| InChI | InChI=1S/C14H20O8/c1-3-12(17)21-9-10(22-13(18)4-2)7-8-20-14(19)6-5-11(15)16/h5-6,10H,3-4,7-9H2,1-2H3,(H,15,16)/b6-5+/t10-/m1/s1 |
| InChIKey | FGVYPOQSKZIXET-BRAIEQGRSA-N |
| XLogP | 0.84 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.31 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|