C5H10NO4- — CID 23322200
N,N-bis(1-hydroxyethyl)carbamate (PubChem CID 23322200) has the molecular formula C5H10NO4- and a molecular weight of 148.14 g/mol. Its IUPAC name is N,N-bis(1-hydroxyethyl)carbamate.
| Compound Name | N,N-bis(1-hydroxyethyl)carbamate |
|---|---|
| PubChem CID | 23322200 |
| Molecular Formula | C5H10NO4- |
| Molecular Weight | 148.14 g/mol |
| Exact Mass | 148.06 |
| IUPAC Name | N,N-bis(1-hydroxyethyl)carbamate |
| SMILES | CC(O)N(C(=O)[O-])C(C)O |
| InChI | InChI=1S/C5H11NO4/c1-3(7)6(4(2)8)5(9)10/h3-4,7-8H,1-2H3,(H,9,10)/p-1 |
| InChIKey | JCSBCLFGXBMMKN-UHFFFAOYSA-M |
| XLogP | -1.69 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.14 |
| LogP ≤ 5 | -1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|