C38H42N2NiO4-4 — CID 58996037
bis(2-[N-methyl-4-(3-phenylbutan-2-yl)anilino]acetic acid);nickel (PubChem CID 58996037) has the molecular formula C38H42N2NiO4-4 and a molecular weight of 649.46 g/mol. Its IUPAC name is bis(2-[N-methyl-4-(3-phenylbutan-2-yl)anilino]acetic acid);nickel.
| Compound Name | bis(2-[N-methyl-4-(3-phenylbutan-2-yl)anilino]acetic acid);nickel |
|---|---|
| PubChem CID | 58996037 |
| Molecular Formula | C38H42N2NiO4-4 |
| Molecular Weight | 649.46 g/mol |
| Exact Mass | 648.25 |
| IUPAC Name | bis(2-[N-methyl-4-(3-phenylbutan-2-yl)anilino]acetic acid);nickel |
| SMILES | [CH2-]C(c1ccccc1)C([CH2-])c1ccc(N(C)CC(=O)O)cc1.[CH2-]C(c1ccccc1)C([CH2-])c1ccc(N(C)CC(=O)O)cc1.[Ni] |
| InChI | InChI=1S/2C19H21NO2.Ni/c2*1-14(16-7-5-4-6-8-16)15(2)17-9-11-18(12-10-17)20(3)13-19(21)22;/h2*4-12,14-15H,1-2,13H2,3H3,(H,21,22);/q2*-2; |
| InChIKey | WGASXPOTKPKOED-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.46 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|