C9H12N2O4 — CID 159174170
2-amino-2-phenylacetic acid;carbamic acid (PubChem CID 159174170) has the molecular formula C9H12N2O4 and a molecular weight of 212.21 g/mol. Its IUPAC name is 2-amino-2-phenylacetic acid;carbamic acid.
| Compound Name | 2-amino-2-phenylacetic acid;carbamic acid |
|---|---|
| PubChem CID | 159174170 |
| Molecular Formula | C9H12N2O4 |
| Molecular Weight | 212.21 g/mol |
| Exact Mass | 212.08 |
| IUPAC Name | 2-amino-2-phenylacetic acid;carbamic acid |
| SMILES | NC(=O)O.NC(C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C8H9NO2.CH3NO2/c9-7(8(10)11)6-4-2-1-3-5-6;2-1(3)4/h1-5,7H,9H2,(H,10,11);2H2,(H,3,4) |
| InChIKey | KMBLLLJKWXGANC-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.21 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |