C10H11NO5 — CID 70149736
4-[(1S,2R)-1-amino-2-carboxy-2-hydroxyethyl]benzoic acid (PubChem CID 70149736) has the molecular formula C10H11NO5 and a molecular weight of 225.20 g/mol. Its IUPAC name is 4-[(1S,2R)-1-amino-2-carboxy-2-hydroxyethyl]benzoic acid.
| Compound Name | 4-[(1S,2R)-1-amino-2-carboxy-2-hydroxyethyl]benzoic acid |
|---|---|
| PubChem CID | 70149736 |
| Molecular Formula | C10H11NO5 |
| Molecular Weight | 225.20 g/mol |
| Exact Mass | 225.06 |
| IUPAC Name | 4-[(1S,2R)-1-amino-2-carboxy-2-hydroxyethyl]benzoic acid |
| SMILES | N[C@@H](c1ccc(C(=O)O)cc1)[C@@H](O)C(=O)O |
| InChI | InChI=1S/C10H11NO5/c11-7(8(12)10(15)16)5-1-3-6(4-2-5)9(13)14/h1-4,7-8,12H,11H2,(H,13,14)(H,15,16)/t7-,8+/m0/s1 |
| InChIKey | XXHWLAKHFUIPJW-JGVFFNPUSA-N |
| XLogP | -0.17 |
| TPSA | 120.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.20 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |