C18H22ClN2O3- — CID 53350784
1-(3-nitrophenyl)-2-(4-phenylbutan-2-ylamino)ethanol chloride (PubChem CID 53350784) has the molecular formula C18H22ClN2O3- and a molecular weight of 349.84 g/mol. Its IUPAC name is 1-(3-nitrophenyl)-2-(4-phenylbutan-2-ylamino)ethanol chloride.
| Compound Name | 1-(3-nitrophenyl)-2-(4-phenylbutan-2-ylamino)ethanol chloride |
|---|---|
| PubChem CID | 53350784 |
| Molecular Formula | C18H22ClN2O3- |
| Molecular Weight | 349.84 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | 1-(3-nitrophenyl)-2-(4-phenylbutan-2-ylamino)ethanol chloride |
| SMILES | CC(CCc1ccccc1)NCC(O)c1cccc([N+](=O)[O-])c1.[Cl-] |
| InChI | InChI=1S/C18H22N2O3.ClH/c1-14(10-11-15-6-3-2-4-7-15)19-13-18(21)16-8-5-9-17(12-16)20(22)23;/h2-9,12,14,18-19,21H,10-11,13H2,1H3;1H/p-1 |
| InChIKey | YRWGEJZMLNDPSQ-UHFFFAOYSA-M |
| XLogP | 0.24 |
| TPSA | 75.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.84 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|