C20H24FNO3 — CID 70590533
methyl 4-[(3R)-3-[[2-(2-fluorophenyl)-2-hydroxyethyl]amino]butyl]benzoate (PubChem CID 70590533) has the molecular formula C20H24FNO3 and a molecular weight of 345.41 g/mol. Its IUPAC name is methyl 4-[(3R)-3-[[2-(2-fluorophenyl)-2-hydroxyethyl]amino]butyl]benzoate.
| Compound Name | methyl 4-[(3R)-3-[[2-(2-fluorophenyl)-2-hydroxyethyl]amino]butyl]benzoate |
|---|---|
| PubChem CID | 70590533 |
| Molecular Formula | C20H24FNO3 |
| Molecular Weight | 345.41 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | methyl 4-[(3R)-3-[[2-(2-fluorophenyl)-2-hydroxyethyl]amino]butyl]benzoate |
| SMILES | COC(=O)c1ccc(CC[C@@H](C)NCC(O)c2ccccc2F)cc1 |
| InChI | InChI=1S/C20H24FNO3/c1-14(22-13-19(23)17-5-3-4-6-18(17)21)7-8-15-9-11-16(12-10-15)20(24)25-2/h3-6,9-12,14,19,22-23H,7-8,13H2,1-2H3/t14-,19?/m1/s1 |
| InChIKey | WOJFWFRRYJYVLL-MJTSIZKDSA-N |
| XLogP | 3.26 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.41 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |