C19H23FN2O3 — CID 110895529
1-[2-(2-fluorophenyl)-2-hydroxyethyl]-3-[4-(4-hydroxyphenyl)butan-2-yl]urea (PubChem CID 110895529) has the molecular formula C19H23FN2O3 and a molecular weight of 346.40 g/mol. Its IUPAC name is 1-[2-(2-fluorophenyl)-2-hydroxyethyl]-3-[4-(4-hydroxyphenyl)butan-2-yl]urea.
| Compound Name | 1-[2-(2-fluorophenyl)-2-hydroxyethyl]-3-[4-(4-hydroxyphenyl)butan-2-yl]urea |
|---|---|
| PubChem CID | 110895529 |
| Molecular Formula | C19H23FN2O3 |
| Molecular Weight | 346.40 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | 1-[2-(2-fluorophenyl)-2-hydroxyethyl]-3-[4-(4-hydroxyphenyl)butan-2-yl]urea |
| SMILES | CC(CCc1ccc(O)cc1)NC(=O)NCC(O)c1ccccc1F |
| InChI | InChI=1S/C19H23FN2O3/c1-13(6-7-14-8-10-15(23)11-9-14)22-19(25)21-12-18(24)16-4-2-3-5-17(16)20/h2-5,8-11,13,18,23-24H,6-7,12H2,1H3,(H2,21,22,25) |
| InChIKey | ZLDWLSBEPBSSCM-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.40 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |