C18H21F2N3O2 — CID 110910380
1-[[4-(dimethylamino)-3-fluorophenyl]methyl]-3-[2-(2-fluorophenyl)-2-hydroxyethyl]urea (PubChem CID 110910380) has the molecular formula C18H21F2N3O2 and a molecular weight of 349.38 g/mol. Its IUPAC name is 1-[[4-(dimethylamino)-3-fluorophenyl]methyl]-3-[2-(2-fluorophenyl)-2-hydroxyethyl]urea.
| Compound Name | 1-[[4-(dimethylamino)-3-fluorophenyl]methyl]-3-[2-(2-fluorophenyl)-2-hydroxyethyl]urea |
|---|---|
| PubChem CID | 110910380 |
| Molecular Formula | C18H21F2N3O2 |
| Molecular Weight | 349.38 g/mol |
| Exact Mass | 349.16 |
| IUPAC Name | 1-[[4-(dimethylamino)-3-fluorophenyl]methyl]-3-[2-(2-fluorophenyl)-2-hydroxyethyl]urea |
| SMILES | CN(C)c1ccc(CNC(=O)NCC(O)c2ccccc2F)cc1F |
| InChI | InChI=1S/C18H21F2N3O2/c1-23(2)16-8-7-12(9-15(16)20)10-21-18(25)22-11-17(24)13-5-3-4-6-14(13)19/h3-9,17,24H,10-11H2,1-2H3,(H2,21,22,25) |
| InChIKey | OEUCSAYLCHSGQX-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.38 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |