C23H24FN3O4 — CID 55929980
1-[[6-(2-ethoxyphenoxy)-3-pyridinyl]methyl]-3-[2-(2-fluorophenyl)-2-hydroxyethyl]urea (PubChem CID 55929980) has the molecular formula C23H24FN3O4 and a molecular weight of 425.46 g/mol. Its IUPAC name is 1-[[6-(2-ethoxyphenoxy)-3-pyridinyl]methyl]-3-[2-(2-fluorophenyl)-2-hydroxyethyl]urea.
| Compound Name | 1-[[6-(2-ethoxyphenoxy)-3-pyridinyl]methyl]-3-[2-(2-fluorophenyl)-2-hydroxyethyl]urea |
|---|---|
| PubChem CID | 55929980 |
| Molecular Formula | C23H24FN3O4 |
| Molecular Weight | 425.46 g/mol |
| Exact Mass | 425.18 |
| IUPAC Name | 1-[[6-(2-ethoxyphenoxy)-3-pyridinyl]methyl]-3-[2-(2-fluorophenyl)-2-hydroxyethyl]urea |
| SMILES | CCOc1ccccc1Oc1ccc(CNC(=O)NCC(O)c2ccccc2F)cn1 |
| InChI | InChI=1S/C23H24FN3O4/c1-2-30-20-9-5-6-10-21(20)31-22-12-11-16(13-25-22)14-26-23(29)27-15-19(28)17-7-3-4-8-18(17)24/h3-13,19,28H,2,14-15H2,1H3,(H2,26,27,29) |
| InChIKey | BQDIHOVWIYDQCM-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 92.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.46 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |