C24H34N4O3 — CID 47066580
1-[[6-(2-ethoxyphenoxy)-3-pyridinyl]methyl]-3-[3-(2-methylpiperidin-1-yl)propyl]urea (PubChem CID 47066580) has the molecular formula C24H34N4O3 and a molecular weight of 426.56 g/mol. Its IUPAC name is 1-[[6-(2-ethoxyphenoxy)-3-pyridinyl]methyl]-3-[3-(2-methylpiperidin-1-yl)propyl]urea.
| Compound Name | 1-[[6-(2-ethoxyphenoxy)-3-pyridinyl]methyl]-3-[3-(2-methylpiperidin-1-yl)propyl]urea |
|---|---|
| PubChem CID | 47066580 |
| Molecular Formula | C24H34N4O3 |
| Molecular Weight | 426.56 g/mol |
| Exact Mass | 426.26 |
| IUPAC Name | 1-[[6-(2-ethoxyphenoxy)-3-pyridinyl]methyl]-3-[3-(2-methylpiperidin-1-yl)propyl]urea |
| SMILES | CCOc1ccccc1Oc1ccc(CNC(=O)NCCCN2CCCCC2C)cn1 |
| InChI | InChI=1S/C24H34N4O3/c1-3-30-21-10-4-5-11-22(21)31-23-13-12-20(17-26-23)18-27-24(29)25-14-8-16-28-15-7-6-9-19(28)2/h4-5,10-13,17,19H,3,6-9,14-16,18H2,1-2H3,(H2,25,27,29) |
| InChIKey | RYXYZZCCHGBDTN-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 75.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.56 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|