C26H28N4O3 — CID 86882869
1-[[6-(2-ethoxyphenoxy)-3-pyridinyl]methyl]-3-[2-(2-methyl-1H-indol-3-yl)ethyl]urea (PubChem CID 86882869) has the molecular formula C26H28N4O3 and a molecular weight of 444.54 g/mol. Its IUPAC name is 1-[[6-(2-ethoxyphenoxy)-3-pyridinyl]methyl]-3-[2-(2-methyl-1H-indol-3-yl)ethyl]urea.
| Compound Name | 1-[[6-(2-ethoxyphenoxy)-3-pyridinyl]methyl]-3-[2-(2-methyl-1H-indol-3-yl)ethyl]urea |
|---|---|
| PubChem CID | 86882869 |
| Molecular Formula | C26H28N4O3 |
| Molecular Weight | 444.54 g/mol |
| Exact Mass | 444.22 |
| IUPAC Name | 1-[[6-(2-ethoxyphenoxy)-3-pyridinyl]methyl]-3-[2-(2-methyl-1H-indol-3-yl)ethyl]urea |
| SMILES | CCOc1ccccc1Oc1ccc(CNC(=O)NCCc2c(C)[nH]c3ccccc23)cn1 |
| InChI | InChI=1S/C26H28N4O3/c1-3-32-23-10-6-7-11-24(23)33-25-13-12-19(16-28-25)17-29-26(31)27-15-14-20-18(2)30-22-9-5-4-8-21(20)22/h4-13,16,30H,3,14-15,17H2,1-2H3,(H2,27,29,31) |
| InChIKey | YWQLNPLBHQGBQI-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 88.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.54 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|