C21H18F2N2O3 — CID 87006586
N-[[6-(2-ethoxyphenoxy)-3-pyridinyl]methyl]-2,6-difluorobenzamide (PubChem CID 87006586) has the molecular formula C21H18F2N2O3 and a molecular weight of 384.38 g/mol. Its IUPAC name is N-[[6-(2-ethoxyphenoxy)-3-pyridinyl]methyl]-2,6-difluorobenzamide.
| Compound Name | N-[[6-(2-ethoxyphenoxy)-3-pyridinyl]methyl]-2,6-difluorobenzamide |
|---|---|
| PubChem CID | 87006586 |
| Molecular Formula | C21H18F2N2O3 |
| Molecular Weight | 384.38 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | N-[[6-(2-ethoxyphenoxy)-3-pyridinyl]methyl]-2,6-difluorobenzamide |
| SMILES | CCOc1ccccc1Oc1ccc(CNC(=O)c2c(F)cccc2F)cn1 |
| InChI | InChI=1S/C21H18F2N2O3/c1-2-27-17-8-3-4-9-18(17)28-19-11-10-14(12-24-19)13-25-21(26)20-15(22)6-5-7-16(20)23/h3-12H,2,13H2,1H3,(H,25,26) |
| InChIKey | TYSGBZOIESPRTA-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.38 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |