C26H30N4O3 — CID 55921755
1-(1-benzylpyrrolidin-3-yl)-3-[[6-(2-ethoxyphenoxy)-3-pyridinyl]methyl]urea (PubChem CID 55921755) has the molecular formula C26H30N4O3 and a molecular weight of 446.55 g/mol. Its IUPAC name is 1-(1-benzylpyrrolidin-3-yl)-3-[[6-(2-ethoxyphenoxy)-3-pyridinyl]methyl]urea.
| Compound Name | 1-(1-benzylpyrrolidin-3-yl)-3-[[6-(2-ethoxyphenoxy)-3-pyridinyl]methyl]urea |
|---|---|
| PubChem CID | 55921755 |
| Molecular Formula | C26H30N4O3 |
| Molecular Weight | 446.55 g/mol |
| Exact Mass | 446.23 |
| IUPAC Name | 1-(1-benzylpyrrolidin-3-yl)-3-[[6-(2-ethoxyphenoxy)-3-pyridinyl]methyl]urea |
| SMILES | CCOc1ccccc1Oc1ccc(CNC(=O)NC2CCN(Cc3ccccc3)C2)cn1 |
| InChI | InChI=1S/C26H30N4O3/c1-2-32-23-10-6-7-11-24(23)33-25-13-12-21(16-27-25)17-28-26(31)29-22-14-15-30(19-22)18-20-8-4-3-5-9-20/h3-13,16,22H,2,14-15,17-19H2,1H3,(H2,28,29,31) |
| InChIKey | SUOKIDBRUHKLAR-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 75.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.55 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |