C48H58F6N4O6 — CID 88732801
bis[2-[1-[4-[2-(dimethylamino)ethoxy]phenyl]propan-2-ylamino]-1-[3-(trifluoromethyl)phenyl]ethyl] (E)-but-2-enedioate (PubChem CID 88732801) has the molecular formula C48H58F6N4O6 and a molecular weight of 901.00 g/mol. Its IUPAC name is bis[2-[1-[4-[2-(dimethylamino)ethoxy]phenyl]propan-2-ylamino]-1-[3-(trifluoromethyl)phenyl]ethyl] (E)-but-2-enedioate.
| Compound Name | bis[2-[1-[4-[2-(dimethylamino)ethoxy]phenyl]propan-2-ylamino]-1-[3-(trifluoromethyl)phenyl]ethyl] (E)-but-2-enedioate |
|---|---|
| PubChem CID | 88732801 |
| Molecular Formula | C48H58F6N4O6 |
| Molecular Weight | 901.00 g/mol |
| Exact Mass | 900.43 |
| IUPAC Name | bis[2-[1-[4-[2-(dimethylamino)ethoxy]phenyl]propan-2-ylamino]-1-[3-(trifluoromethyl)phenyl]ethyl] (E)-but-2-enedioate |
| SMILES | CC(Cc1ccc(OCCN(C)C)cc1)NCC(OC(=O)/C=C/C(=O)OC(CNC(C)Cc1ccc(OCCN(C)C)cc1)c1cccc(C(F)(F)F)c1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C48H58F6N4O6/c1-33(27-35-13-17-41(18-14-35)61-25-23-57(3)4)55-31-43(37-9-7-11-39(29-37)47(49,50)51)63-45(59)21-22-46(60)64-44(38-10-8-12-40(30-38)48(52,53)54)32-56-34(2)28-36-15-19-42(20-16-36)62-26-24-58(5)6/h7-22,29-30,33-34,43-44,55-56H,23-28,31-32H2,1-6H3/b22-21+ |
| InChIKey | ZVFLMSVVMSFRNR-QURGRASLSA-N |
| XLogP | 8.47 |
| TPSA | 101.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 901.00 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|