C21H29BrN2O2 — CID 70471616
N-[2-(3-bromophenyl)-2-methoxyethyl]-1-[4-[2-(methylamino)ethoxy]phenyl]propan-2-amine (PubChem CID 70471616) has the molecular formula C21H29BrN2O2 and a molecular weight of 421.38 g/mol. Its IUPAC name is N-[2-(3-bromophenyl)-2-methoxyethyl]-1-[4-[2-(methylamino)ethoxy]phenyl]propan-2-amine.
| Compound Name | N-[2-(3-bromophenyl)-2-methoxyethyl]-1-[4-[2-(methylamino)ethoxy]phenyl]propan-2-amine |
|---|---|
| PubChem CID | 70471616 |
| Molecular Formula | C21H29BrN2O2 |
| Molecular Weight | 421.38 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | N-[2-(3-bromophenyl)-2-methoxyethyl]-1-[4-[2-(methylamino)ethoxy]phenyl]propan-2-amine |
| SMILES | CNCCOc1ccc(CC(C)NCC(OC)c2cccc(Br)c2)cc1 |
| InChI | InChI=1S/C21H29BrN2O2/c1-16(13-17-7-9-20(10-8-17)26-12-11-23-2)24-15-21(25-3)18-5-4-6-19(22)14-18/h4-10,14,16,21,23-24H,11-13,15H2,1-3H3 |
| InChIKey | OLXHXBKFBXCFMF-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.38 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|