C20H29Br2FN2O2 — CID 70468513
1-(3-fluorophenyl)-2-[1-[4-[2-(methylamino)ethoxy]phenyl]propan-2-ylamino]ethanol;dihydrobromide (PubChem CID 70468513) has the molecular formula C20H29Br2FN2O2 and a molecular weight of 508.27 g/mol. Its IUPAC name is 1-(3-fluorophenyl)-2-[1-[4-[2-(methylamino)ethoxy]phenyl]propan-2-ylamino]ethanol;dihydrobromide.
| Compound Name | 1-(3-fluorophenyl)-2-[1-[4-[2-(methylamino)ethoxy]phenyl]propan-2-ylamino]ethanol;dihydrobromide |
|---|---|
| PubChem CID | 70468513 |
| Molecular Formula | C20H29Br2FN2O2 |
| Molecular Weight | 508.27 g/mol |
| Exact Mass | 506.06 |
| IUPAC Name | 1-(3-fluorophenyl)-2-[1-[4-[2-(methylamino)ethoxy]phenyl]propan-2-ylamino]ethanol;dihydrobromide |
| SMILES | Br.Br.CNCCOc1ccc(CC(C)NCC(O)c2cccc(F)c2)cc1 |
| InChI | InChI=1S/C20H27FN2O2.2BrH/c1-15(23-14-20(24)17-4-3-5-18(21)13-17)12-16-6-8-19(9-7-16)25-11-10-22-2;;/h3-9,13,15,20,22-24H,10-12,14H2,1-2H3;2*1H |
| InChIKey | CZVGCSGBIYVTIU-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 53.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.27 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|