C15H24FNO — CID 60979915
1-(3-fluorophenyl)-2-(5-methylhexan-2-ylamino)ethanol (PubChem CID 60979915) has the molecular formula C15H24FNO and a molecular weight of 253.36 g/mol. Its IUPAC name is 1-(3-fluorophenyl)-2-(5-methylhexan-2-ylamino)ethanol.
| Compound Name | 1-(3-fluorophenyl)-2-(5-methylhexan-2-ylamino)ethanol |
|---|---|
| PubChem CID | 60979915 |
| Molecular Formula | C15H24FNO |
| Molecular Weight | 253.36 g/mol |
| Exact Mass | 253.18 |
| IUPAC Name | 1-(3-fluorophenyl)-2-(5-methylhexan-2-ylamino)ethanol |
| SMILES | CC(C)CCC(C)NCC(O)c1cccc(F)c1 |
| InChI | InChI=1S/C15H24FNO/c1-11(2)7-8-12(3)17-10-15(18)13-5-4-6-14(16)9-13/h4-6,9,11-12,15,17-18H,7-8,10H2,1-3H3 |
| InChIKey | NLMDWQFZSVBYJA-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.36 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |