C10H15NO4S2 — CID 90473582
(1S)-2-(2-hydroxysulfonothioyloxyethylamino)-1-phenylethanol (PubChem CID 90473582) has the molecular formula C10H15NO4S2 and a molecular weight of 277.37 g/mol. Its IUPAC name is (1S)-2-(2-hydroxysulfonothioyloxyethylamino)-1-phenylethanol.
| Compound Name | (1S)-2-(2-hydroxysulfonothioyloxyethylamino)-1-phenylethanol |
|---|---|
| PubChem CID | 90473582 |
| Molecular Formula | C10H15NO4S2 |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.04 |
| IUPAC Name | (1S)-2-(2-hydroxysulfonothioyloxyethylamino)-1-phenylethanol |
| SMILES | O=S(O)(=S)OCCNC[C@@H](O)c1ccccc1 |
| InChI | InChI=1S/C10H15NO4S2/c12-10(9-4-2-1-3-5-9)8-11-6-7-15-17(13,14)16/h1-5,10-12H,6-8H2,(H,13,14,16)/t10-/m1/s1 |
| InChIKey | DHNQNGVJDAXMBO-SNVBAGLBSA-N |
| XLogP | 0.46 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|