C12H17F2NO3S — CID 54905559
1-(2,5-difluorophenyl)-2-(3-methylsulfonylpropylamino)ethanol (PubChem CID 54905559) has the molecular formula C12H17F2NO3S and a molecular weight of 293.33 g/mol. Its IUPAC name is 1-(2,5-difluorophenyl)-2-(3-methylsulfonylpropylamino)ethanol.
| Compound Name | 1-(2,5-difluorophenyl)-2-(3-methylsulfonylpropylamino)ethanol |
|---|---|
| PubChem CID | 54905559 |
| Molecular Formula | C12H17F2NO3S |
| Molecular Weight | 293.33 g/mol |
| Exact Mass | 293.09 |
| IUPAC Name | 1-(2,5-difluorophenyl)-2-(3-methylsulfonylpropylamino)ethanol |
| SMILES | CS(=O)(=O)CCCNCC(O)c1cc(F)ccc1F |
| InChI | InChI=1S/C12H17F2NO3S/c1-19(17,18)6-2-5-15-8-12(16)10-7-9(13)3-4-11(10)14/h3-4,7,12,15-16H,2,5-6,8H2,1H3 |
| InChIKey | VMZLTTKZRWJYIJ-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.33 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|