C14H19F2NO3 — CID 82316123
6-[[2-(2,5-difluorophenyl)-2-hydroxyethyl]amino]hexanoic acid (PubChem CID 82316123) has the molecular formula C14H19F2NO3 and a molecular weight of 287.31 g/mol. Its IUPAC name is 6-[[2-(2,5-difluorophenyl)-2-hydroxyethyl]amino]hexanoic acid.
| Compound Name | 6-[[2-(2,5-difluorophenyl)-2-hydroxyethyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 82316123 |
| Molecular Formula | C14H19F2NO3 |
| Molecular Weight | 287.31 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | 6-[[2-(2,5-difluorophenyl)-2-hydroxyethyl]amino]hexanoic acid |
| SMILES | O=C(O)CCCCCNCC(O)c1cc(F)ccc1F |
| InChI | InChI=1S/C14H19F2NO3/c15-10-5-6-12(16)11(8-10)13(18)9-17-7-3-1-2-4-14(19)20/h5-6,8,13,17-18H,1-4,7,9H2,(H,19,20) |
| InChIKey | QXLQGNZZETVQLE-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.31 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|