C16H20O4S — CID 65148541
1-(6-methoxynaphthalen-2-yl)-4-methylsulfonylbutan-1-ol (PubChem CID 65148541) has the molecular formula C16H20O4S and a molecular weight of 308.40 g/mol. Its IUPAC name is 1-(6-methoxynaphthalen-2-yl)-4-methylsulfonylbutan-1-ol.
| Compound Name | 1-(6-methoxynaphthalen-2-yl)-4-methylsulfonylbutan-1-ol |
|---|---|
| PubChem CID | 65148541 |
| Molecular Formula | C16H20O4S |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.11 |
| IUPAC Name | 1-(6-methoxynaphthalen-2-yl)-4-methylsulfonylbutan-1-ol |
| SMILES | COc1ccc2cc(C(O)CCCS(C)(=O)=O)ccc2c1 |
| InChI | InChI=1S/C16H20O4S/c1-20-15-8-7-12-10-14(6-5-13(12)11-15)16(17)4-3-9-21(2,18)19/h5-8,10-11,16-17H,3-4,9H2,1-2H3 |
| InChIKey | DWQOZDURYBVGCU-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |