About 4-[4-[3-[4-(trifluoromethoxy)phenyl]propyl]piperidin-1-yl]-3H-1,3-benzothiazol-2-one
4-[4-[3-[4-(trifluoromethoxy)phenyl]propyl]piperidin-1-yl]-3H-1,3-benzothiazol-2-one (PubChem CID 91415096) has the molecular formula C22H23F3N2O2S
and a molecular weight of 436.50 g/mol. Its IUPAC name is 4-[4-[3-[4-(trifluoromethoxy)phenyl]propyl]piperidin-1-yl]-3H-1,3-benzothiazol-2-one.
Molecular Properties
| Compound Name | 4-[4-[3-[4-(trifluoromethoxy)phenyl]propyl]piperidin-1-yl]-3H-1,3-benzothiazol-2-one |
| PubChem CID | 91415096 |
| Molecular Formula | C22H23F3N2O2S |
| Molecular Weight | 436.50 g/mol |
| Exact Mass | 436.14 |
| IUPAC Name | 4-[4-[3-[4-(trifluoromethoxy)phenyl]propyl]piperidin-1-yl]-3H-1,3-benzothiazol-2-one |
| SMILES | O=c1[nH]c2c(N3CCC(CCCc4ccc(OC(F)(F)F)cc4)CC3)cccc2s1 |
| InChI | InChI=1S/C22H23F3N2O2S/c23-22(24,25)29-17-9-7-15(8-10-17)3-1-4-16-11-13-27(14-12-16)18-5-2-6-19-20(18)26-21(28)30-19/h2,5-10,16H,1,3-4,11-14H2,(H,26,28) |
| InChIKey | MIQAXCSSHGYOCZ-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 436.50 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[4-[3-[4-(trifluoromethoxy)phenyl]propyl]piperidin-1-yl]-3H-1,3-benzothiazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-[3-[4-(trifluoromethoxy)phenyl]propyl]piperidin-1-yl]-3H-1,3-benzothiazol-2-one?
The IUPAC name of 4-[4-[3-[4-(trifluoromethoxy)phenyl]propyl]piperidin-1-yl]-3H-1,3-benzothiazol-2-one (CID 91415096) is 4-[4-[3-[4-(trifluoromethoxy)phenyl]propyl]piperidin-1-yl]-3H-1,3-benzothiazol-2-one.
What is the SMILES notation for 4-[4-[3-[4-(trifluoromethoxy)phenyl]propyl]piperidin-1-yl]-3H-1,3-benzothiazol-2-one?
The canonical SMILES for 4-[4-[3-[4-(trifluoromethoxy)phenyl]propyl]piperidin-1-yl]-3H-1,3-benzothiazol-2-one is O=c1[nH]c2c(N3CCC(CCCc4ccc(OC(F)(F)F)cc4)CC3)cccc2s1.
What is the InChIKey of 4-[4-[3-[4-(trifluoromethoxy)phenyl]propyl]piperidin-1-yl]-3H-1,3-benzothiazol-2-one?
The InChIKey is MIQAXCSSHGYOCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H23F3N2O2S/c23-22(24,25)29-17-9-7-15(8-10-17)3-1-4-16-11-13-27(14-12-16)18-5-2-6-19-20(18)26-21(28)30-19/h2,5-10,16H,1,3-4,11-14H2,(H,26,28).
What are the key properties of 4-[4-[3-[4-(trifluoromethoxy)phenyl]propyl]piperidin-1-yl]-3H-1,3-benzothiazol-2-one?
4-[4-[3-[4-(trifluoromethoxy)phenyl]propyl]piperidin-1-yl]-3H-1,3-benzothiazol-2-one has a molecular weight of 436.50 g/mol, XLogP of 5.73, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-[3-[4-(trifluoromethoxy)phenyl]propyl]piperidin-1-yl]-3H-1,3-benzothiazol-2-one is sourced from PubChem (CID 91415096), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).