C24H28F3N3OS — CID 174498413
4-[4-[6-[4-(trifluoromethoxy)phenyl]hexyl]piperazin-1-yl]-1,3-benzothiazole (PubChem CID 174498413) has the molecular formula C24H28F3N3OS and a molecular weight of 463.57 g/mol. Its IUPAC name is 4-[4-[6-[4-(trifluoromethoxy)phenyl]hexyl]piperazin-1-yl]-1,3-benzothiazole.
| Compound Name | 4-[4-[6-[4-(trifluoromethoxy)phenyl]hexyl]piperazin-1-yl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 174498413 |
| Molecular Formula | C24H28F3N3OS |
| Molecular Weight | 463.57 g/mol |
| Exact Mass | 463.19 |
| IUPAC Name | 4-[4-[6-[4-(trifluoromethoxy)phenyl]hexyl]piperazin-1-yl]-1,3-benzothiazole |
| SMILES | FC(F)(F)Oc1ccc(CCCCCCN2CCN(c3cccc4scnc34)CC2)cc1 |
| InChI | InChI=1S/C24H28F3N3OS/c25-24(26,27)31-20-11-9-19(10-12-20)6-3-1-2-4-13-29-14-16-30(17-15-29)21-7-5-8-22-23(21)28-18-32-22/h5,7-12,18H,1-4,6,13-17H2 |
| InChIKey | LGQCTXNHRPJMAR-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 28.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.57 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|