C24H29F3N2O3 — CID 71155087
5-[4-[2-[4-[2-(trifluoromethyl)phenyl]piperazin-1-yl]ethoxy]phenyl]pentanoic acid (PubChem CID 71155087) has the molecular formula C24H29F3N2O3 and a molecular weight of 450.50 g/mol. Its IUPAC name is 5-[4-[2-[4-[2-(trifluoromethyl)phenyl]piperazin-1-yl]ethoxy]phenyl]pentanoic acid.
| Compound Name | 5-[4-[2-[4-[2-(trifluoromethyl)phenyl]piperazin-1-yl]ethoxy]phenyl]pentanoic acid |
|---|---|
| PubChem CID | 71155087 |
| Molecular Formula | C24H29F3N2O3 |
| Molecular Weight | 450.50 g/mol |
| Exact Mass | 450.21 |
| IUPAC Name | 5-[4-[2-[4-[2-(trifluoromethyl)phenyl]piperazin-1-yl]ethoxy]phenyl]pentanoic acid |
| SMILES | O=C(O)CCCCc1ccc(OCCN2CCN(c3ccccc3C(F)(F)F)CC2)cc1 |
| InChI | InChI=1S/C24H29F3N2O3/c25-24(26,27)21-6-2-3-7-22(21)29-15-13-28(14-16-29)17-18-32-20-11-9-19(10-12-20)5-1-4-8-23(30)31/h2-3,6-7,9-12H,1,4-5,8,13-18H2,(H,30,31) |
| InChIKey | RJXIFVRFSHMKLF-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.50 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|