C17H26F3N3 — CID 139693229
6-[4-[2-(trifluoromethyl)phenyl]piperazin-1-yl]hexan-1-amine (PubChem CID 139693229) has the molecular formula C17H26F3N3 and a molecular weight of 329.41 g/mol. Its IUPAC name is 6-[4-[2-(trifluoromethyl)phenyl]piperazin-1-yl]hexan-1-amine.
| Compound Name | 6-[4-[2-(trifluoromethyl)phenyl]piperazin-1-yl]hexan-1-amine |
|---|---|
| PubChem CID | 139693229 |
| Molecular Formula | C17H26F3N3 |
| Molecular Weight | 329.41 g/mol |
| Exact Mass | 329.21 |
| IUPAC Name | 6-[4-[2-(trifluoromethyl)phenyl]piperazin-1-yl]hexan-1-amine |
| SMILES | NCCCCCCN1CCN(c2ccccc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C17H26F3N3/c18-17(19,20)15-7-3-4-8-16(15)23-13-11-22(12-14-23)10-6-2-1-5-9-21/h3-4,7-8H,1-2,5-6,9-14,21H2 |
| InChIKey | ZUQVEJMFAWVNPP-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.41 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|