C24H23F3N4O2 — CID 59810985
2-[4-[4-(1,3-dioxoisoindol-2-yl)butyl]piperazin-1-yl]-6-(trifluoromethyl)benzonitrile (PubChem CID 59810985) has the molecular formula C24H23F3N4O2 and a molecular weight of 456.47 g/mol. Its IUPAC name is 2-[4-[4-(1,3-dioxoisoindol-2-yl)butyl]piperazin-1-yl]-6-(trifluoromethyl)benzonitrile.
| Compound Name | 2-[4-[4-(1,3-dioxoisoindol-2-yl)butyl]piperazin-1-yl]-6-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 59810985 |
| Molecular Formula | C24H23F3N4O2 |
| Molecular Weight | 456.47 g/mol |
| Exact Mass | 456.18 |
| IUPAC Name | 2-[4-[4-(1,3-dioxoisoindol-2-yl)butyl]piperazin-1-yl]-6-(trifluoromethyl)benzonitrile |
| SMILES | N#Cc1c(N2CCN(CCCCN3C(=O)c4ccccc4C3=O)CC2)cccc1C(F)(F)F |
| InChI | InChI=1S/C24H23F3N4O2/c25-24(26,27)20-8-5-9-21(19(20)16-28)30-14-12-29(13-15-30)10-3-4-11-31-22(32)17-6-1-2-7-18(17)23(31)33/h1-2,5-9H,3-4,10-15H2 |
| InChIKey | FOMPTLPCPVOAIJ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 67.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.47 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|