C9H13N3O5 — CID 23081554
2-[2-(methoxymethoxy)ethyl]-6-nitro-2,3-dihydroimidazo[2,1-b][1,3]oxazole (PubChem CID 23081554) has the molecular formula C9H13N3O5 and a molecular weight of 243.22 g/mol. Its IUPAC name is 2-[2-(methoxymethoxy)ethyl]-6-nitro-2,3-dihydroimidazo[2,1-b][1,3]oxazole.
| Compound Name | 2-[2-(methoxymethoxy)ethyl]-6-nitro-2,3-dihydroimidazo[2,1-b][1,3]oxazole |
|---|---|
| PubChem CID | 23081554 |
| Molecular Formula | C9H13N3O5 |
| Molecular Weight | 243.22 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | 2-[2-(methoxymethoxy)ethyl]-6-nitro-2,3-dihydroimidazo[2,1-b][1,3]oxazole |
| SMILES | COCOCCC1Cn2cc([N+](=O)[O-])nc2O1 |
| InChI | InChI=1S/C9H13N3O5/c1-15-6-16-3-2-7-4-11-5-8(12(13)14)10-9(11)17-7/h5,7H,2-4,6H2,1H3 |
| InChIKey | AIRVMQVDXVVKTH-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 88.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.22 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|