C12H15N3O6 — CID 56949969
(2R)-2-[(3aR,4R,6aR)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-6-nitro-2,3-dihydroimidazo[2,1-b][1,3]oxazole (PubChem CID 56949969) has the molecular formula C12H15N3O6 and a molecular weight of 297.27 g/mol. Its IUPAC name is (2R)-2-[(3aR,4R,6aR)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-6-nitro-2,3-dihydroimidazo[2,1-b][1,3]oxazole.
| Compound Name | (2R)-2-[(3aR,4R,6aR)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-6-nitro-2,3-dihydroimidazo[2,1-b][1,3]oxazole |
|---|---|
| PubChem CID | 56949969 |
| Molecular Formula | C12H15N3O6 |
| Molecular Weight | 297.27 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | (2R)-2-[(3aR,4R,6aR)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-6-nitro-2,3-dihydroimidazo[2,1-b][1,3]oxazole |
| SMILES | CC1(C)O[C@H]2[C@@H]([C@H]3Cn4cc([N+](=O)[O-])nc4O3)OC[C@H]2O1 |
| InChI | InChI=1S/C12H15N3O6/c1-12(2)20-7-5-18-9(10(7)21-12)6-3-14-4-8(15(16)17)13-11(14)19-6/h4,6-7,9-10H,3,5H2,1-2H3/t6-,7-,9-,10-/m1/s1 |
| InChIKey | BKKADWSYIZGPJJ-KHUVANEUSA-N |
| XLogP | 0.47 |
| TPSA | 97.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.27 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|