C31H41N5O3Si — CID 68769357
tert-butyl 4-[5-cyclopropyl-1-[(4-methoxyphenyl)methyl]-3-(2-trimethylsilylethynyl)pyrazolo[3,4-b]pyridin-4-yl]piperazine-1-carboxylate (PubChem CID 68769357) has the molecular formula C31H41N5O3Si and a molecular weight of 559.79 g/mol. Its IUPAC name is tert-butyl 4-[5-cyclopropyl-1-[(4-methoxyphenyl)methyl]-3-(2-trimethylsilylethynyl)pyrazolo[3,4-b]pyridin-4-yl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[5-cyclopropyl-1-[(4-methoxyphenyl)methyl]-3-(2-trimethylsilylethynyl)pyrazolo[3,4-b]pyridin-4-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 68769357 |
| Molecular Formula | C31H41N5O3Si |
| Molecular Weight | 559.79 g/mol |
| Exact Mass | 559.30 |
| IUPAC Name | tert-butyl 4-[5-cyclopropyl-1-[(4-methoxyphenyl)methyl]-3-(2-trimethylsilylethynyl)pyrazolo[3,4-b]pyridin-4-yl]piperazine-1-carboxylate |
| SMILES | COc1ccc(Cn2nc(C#C[Si](C)(C)C)c3c(N4CCN(C(=O)OC(C)(C)C)CC4)c(C4CC4)cnc32)cc1 |
| InChI | InChI=1S/C31H41N5O3Si/c1-31(2,3)39-30(37)35-17-15-34(16-18-35)28-25(23-10-11-23)20-32-29-27(28)26(14-19-40(5,6)7)33-36(29)21-22-8-12-24(38-4)13-9-22/h8-9,12-13,20,23H,10-11,15-18,21H2,1-7H3 |
| InChIKey | GMHFIZUVOJVHCL-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 72.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.79 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|